C12H19F3O — CID 143587510
1-(2-methylprop-2-enyl)-3-(2,2,2-trifluoroethoxy)cyclohexane (PubChem CID 143587510) has the molecular formula C12H19F3O and a molecular weight of 236.28 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-3-(2,2,2-trifluoroethoxy)cyclohexane.
| Compound Name | 1-(2-methylprop-2-enyl)-3-(2,2,2-trifluoroethoxy)cyclohexane |
|---|---|
| PubChem CID | 143587510 |
| Molecular Formula | C12H19F3O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-3-(2,2,2-trifluoroethoxy)cyclohexane |
| SMILES | C=C(C)CC1CCCC(OCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H19F3O/c1-9(2)6-10-4-3-5-11(7-10)16-8-12(13,14)15/h10-11H,1,3-8H2,2H3 |
| InChIKey | VZSLSVZJQQNTGM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|