C36H55FN6O4 — CID 143587748
ethane;5-N-[(3E)-3-ethylidene-6-(3-methyl-5-oxo-4H-1,4-oxazin-2-yl)hex-5-enyl]-3-fluoro-7-N-(2,3,5-triethylheptyl)pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide (PubChem CID 143587748) has the molecular formula C36H55FN6O4 and a molecular weight of 654.87 g/mol. Its IUPAC name is ethane;5-N-[(3E)-3-ethylidene-6-(3-methyl-5-oxo-4H-1,4-oxazin-2-yl)hex-5-enyl]-3-fluoro-7-N-(2,3,5-triethylheptyl)pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide.
| Compound Name | ethane;5-N-[(3E)-3-ethylidene-6-(3-methyl-5-oxo-4H-1,4-oxazin-2-yl)hex-5-enyl]-3-fluoro-7-N-(2,3,5-triethylheptyl)pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 143587748 |
| Molecular Formula | C36H55FN6O4 |
| Molecular Weight | 654.87 g/mol |
| Exact Mass | 654.43 |
| IUPAC Name | ethane;5-N-[(3E)-3-ethylidene-6-(3-methyl-5-oxo-4H-1,4-oxazin-2-yl)hex-5-enyl]-3-fluoro-7-N-(2,3,5-triethylheptyl)pyrazolo[1,5-a]pyrimidine-5,7-dicarboxamide |
| SMILES | C/C=C(\CC=CC1=C(C)NC(=O)CO1)CCNC(=O)c1cc(C(=O)NCC(CC)C(CC)CC(CC)CC)n2ncc(F)c2n1.CC |
| InChI | InChI=1S/C34H49FN6O4.C2H6/c1-7-23(8-2)17-25(10-4)26(11-5)19-37-34(44)29-18-28(40-32-27(35)20-38-41(29)32)33(43)36-16-15-24(9-3)13-12-14-30-22(6)39-31(42)21-45-30;1-2/h9,12,14,18,20,23,25-26H,7-8,10-11,13,15-17,19,21H2,1-6H3,(H,36,43)(H,37,44)(H,39,42);1-2H3/b14-12?,24-9+; |
| InChIKey | HPVCJRYNGMOAIO-MMMVZRTHSA-N |
| XLogP | 6.89 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.87 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|