About tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate
tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 143587790) has the molecular formula C16H22O2
and a molecular weight of 246.35 g/mol. Its IUPAC name is tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate.
Analyze tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate?
The IUPAC name of tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate (CID 143587790) is tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate.
What is the SMILES notation for tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate?
The canonical SMILES for tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate is Cc1c(C(=O)OC(C)(C)C)ccc2c1CCC2C.
What is the InChIKey of tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate?
The InChIKey is XSIVTFCQBPNVKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2/c1-10-6-7-13-11(2)14(9-8-12(10)13)15(17)18-16(3,4)5/h8-10H,6-7H2,1-5H3.
What are the key properties of tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate?
tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate has a molecular weight of 246.35 g/mol, XLogP of 4.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 1,4-dimethyl-2,3-dihydro-1H-indene-5-carboxylate is sourced from PubChem (CID 143587790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).