C23H42N2O2 — CID 143587859
N,N-dimethylmethanamine;ethane;1-(8-ethyl-2,3,4,7-tetrahydrocyclohepta[b]pyridin-1-yl)butane-2,3-dione (PubChem CID 143587859) has the molecular formula C23H42N2O2 and a molecular weight of 378.60 g/mol. Its IUPAC name is N,N-dimethylmethanamine;ethane;1-(8-ethyl-2,3,4,7-tetrahydrocyclohepta[b]pyridin-1-yl)butane-2,3-dione.
| Compound Name | N,N-dimethylmethanamine;ethane;1-(8-ethyl-2,3,4,7-tetrahydrocyclohepta[b]pyridin-1-yl)butane-2,3-dione |
|---|---|
| PubChem CID | 143587859 |
| Molecular Formula | C23H42N2O2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.32 |
| IUPAC Name | N,N-dimethylmethanamine;ethane;1-(8-ethyl-2,3,4,7-tetrahydrocyclohepta[b]pyridin-1-yl)butane-2,3-dione |
| SMILES | CC.CC.CCC1=CC2=C(C=CC1)CCCN2CC(=O)C(C)=O.CN(C)C |
| InChI | InChI=1S/C16H21NO2.C3H9N.2C2H6/c1-3-13-6-4-7-14-8-5-9-17(15(14)10-13)11-16(19)12(2)18;1-4(2)3;2*1-2/h4,7,10H,3,5-6,8-9,11H2,1-2H3;1-3H3;2*1-2H3 |
| InChIKey | FBQNDGFHIVMPOV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|