C9H15NO — CID 143587885
6-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole (PubChem CID 143587885) has the molecular formula C9H15NO and a molecular weight of 153.23 g/mol. Its IUPAC name is 6-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole.
| Compound Name | 6-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 143587885 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 6-ethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole |
| SMILES | CCC1CCC2N=COC2C1 |
| InChI | InChI=1S/C9H15NO/c1-2-7-3-4-8-9(5-7)11-6-10-8/h6-9H,2-5H2,1H3 |
| InChIKey | ZFAXNAUOPTZGRK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |