C14H22N2O2 — CID 143587976
5-ethenyl-2,2-dimethyl-6-[(Z)-5-(methylamino)pent-1-enyl]-4H-1,4-oxazin-3-one (PubChem CID 143587976) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 5-ethenyl-2,2-dimethyl-6-[(Z)-5-(methylamino)pent-1-enyl]-4H-1,4-oxazin-3-one.
| Compound Name | 5-ethenyl-2,2-dimethyl-6-[(Z)-5-(methylamino)pent-1-enyl]-4H-1,4-oxazin-3-one |
|---|---|
| PubChem CID | 143587976 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 5-ethenyl-2,2-dimethyl-6-[(Z)-5-(methylamino)pent-1-enyl]-4H-1,4-oxazin-3-one |
| SMILES | C=CC1=C(/C=C\CCCNC)OC(C)(C)C(=O)N1 |
| InChI | InChI=1S/C14H22N2O2/c1-5-11-12(9-7-6-8-10-15-4)18-14(2,3)13(17)16-11/h5,7,9,15H,1,6,8,10H2,2-4H3,(H,16,17)/b9-7- |
| InChIKey | DJZBQRIUXCVRJT-CLFYSBASSA-N |
| XLogP | 1.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|