About (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane
(Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane (PubChem CID 143588223) has the molecular formula C15H32S
and a molecular weight of 244.49 g/mol. Its IUPAC name is (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane.
Molecular Properties
| Compound Name | (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane |
| PubChem CID | 143588223 |
| Molecular Formula | C15H32S |
| Molecular Weight | 244.49 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane |
| SMILES | C/C=C(\S/C=C/CC)C(C)(C)C.CC.CC |
| InChI | InChI=1S/C11H20S.2C2H6/c1-6-8-9-12-10(7-2)11(3,4)5;2*1-2/h7-9H,6H2,1-5H3;2*1-2H3/b9-8+,10-7-;; |
| InChIKey | SKWAQXWIUMTAOK-SSOBFKOJSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane?
The IUPAC name of (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane (CID 143588223) is (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane.
What is the SMILES notation for (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane?
The canonical SMILES for (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane is C/C=C(\S/C=C/CC)C(C)(C)C.CC.CC.
What is the InChIKey of (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane?
The InChIKey is SKWAQXWIUMTAOK-SSOBFKOJSA-N. The full InChI is InChI=1S/C11H20S.2C2H6/c1-6-8-9-12-10(7-2)11(3,4)5;2*1-2/h7-9H,6H2,1-5H3;2*1-2H3/b9-8+,10-7-;;.
What are the key properties of (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane?
(Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane has a molecular weight of 244.49 g/mol, XLogP of 6.65, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[(E)-but-1-enyl]sulfanyl-4,4-dimethylpent-2-ene;ethane is sourced from PubChem (CID 143588223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).