About 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene
4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene (PubChem CID 143588674) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene.
Molecular Properties
| Compound Name | 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene |
| PubChem CID | 143588674 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene |
| SMILES | C/C=C(\C)CC.C=CC1=CC(=O)N(C)CC1 |
| InChI | InChI=1S/C8H11NO.C6H12/c1-3-7-4-5-9(2)8(10)6-7;1-4-6(3)5-2/h3,6H,1,4-5H2,2H3;4H,5H2,1-3H3/b;6-4+ |
| InChIKey | ACZZHUURTRURSX-DVXCEAISSA-N |
| XLogP | 3.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene?
The IUPAC name of 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene (CID 143588674) is 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene.
What is the SMILES notation for 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene?
The canonical SMILES for 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene is C/C=C(\C)CC.C=CC1=CC(=O)N(C)CC1.
What is the InChIKey of 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene?
The InChIKey is ACZZHUURTRURSX-DVXCEAISSA-N. The full InChI is InChI=1S/C8H11NO.C6H12/c1-3-7-4-5-9(2)8(10)6-7;1-4-6(3)5-2/h3,6H,1,4-5H2,2H3;4H,5H2,1-3H3/b;6-4+.
What are the key properties of 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene?
4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene has a molecular weight of 221.34 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-1-methyl-2,3-dihydropyridin-6-one;(E)-3-methylpent-2-ene is sourced from PubChem (CID 143588674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).