C18H29NO — CID 143588712
N-butyl-N-(6-propylcyclohepta-1,3,4,6-tetraen-1-yl)formamide;propane (PubChem CID 143588712) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is N-butyl-N-(6-propylcyclohepta-1,3,4,6-tetraen-1-yl)formamide;propane.
| Compound Name | N-butyl-N-(6-propylcyclohepta-1,3,4,6-tetraen-1-yl)formamide;propane |
|---|---|
| PubChem CID | 143588712 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | N-butyl-N-(6-propylcyclohepta-1,3,4,6-tetraen-1-yl)formamide;propane |
| SMILES | CCC.CCCCN(C=O)C1=CC=C=CC(CCC)=C1 |
| InChI | InChI=1S/C15H21NO.C3H8/c1-3-5-11-16(13-17)15-10-7-6-9-14(12-15)8-4-2;1-3-2/h7,9-10,12-13H,3-5,8,11H2,1-2H3;3H2,1-2H3 |
| InChIKey | JMXQSMGEHKCKHR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|