C15H25F3O — CID 143588795
ethane;(2E,4E)-5-methyl-3-(2,2,2-trifluoroethoxy)hepta-2,4-diene;prop-1-yne (PubChem CID 143588795) has the molecular formula C15H25F3O and a molecular weight of 278.36 g/mol. Its IUPAC name is ethane;(2E,4E)-5-methyl-3-(2,2,2-trifluoroethoxy)hepta-2,4-diene;prop-1-yne.
| Compound Name | ethane;(2E,4E)-5-methyl-3-(2,2,2-trifluoroethoxy)hepta-2,4-diene;prop-1-yne |
|---|---|
| PubChem CID | 143588795 |
| Molecular Formula | C15H25F3O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethane;(2E,4E)-5-methyl-3-(2,2,2-trifluoroethoxy)hepta-2,4-diene;prop-1-yne |
| SMILES | C#CC.C/C=C(\C=C(/C)CC)OCC(F)(F)F.CC |
| InChI | InChI=1S/C10H15F3O.C3H4.C2H6/c1-4-8(3)6-9(5-2)14-7-10(11,12)13;1-3-2;1-2/h5-6H,4,7H2,1-3H3;1H,2H3;1-2H3/b8-6+,9-5+;; |
| InChIKey | QCIWDVIIXZEENM-VLGINLMBSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|