C16H15N3O3 — CID 143589119
4-[4-(4-methoxyphenyl)-5-methylidene-1H-1,2,4-triazol-3-yl]benzene-1,3-diol (PubChem CID 143589119) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)-5-methylidene-1H-1,2,4-triazol-3-yl]benzene-1,3-diol.
| Compound Name | 4-[4-(4-methoxyphenyl)-5-methylidene-1H-1,2,4-triazol-3-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 143589119 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)-5-methylidene-1H-1,2,4-triazol-3-yl]benzene-1,3-diol |
| SMILES | C=C1NN=C(c2ccc(O)cc2O)N1c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H15N3O3/c1-10-17-18-16(14-8-5-12(20)9-15(14)21)19(10)11-3-6-13(22-2)7-4-11/h3-9,17,20-21H,1H2,2H3 |
| InChIKey | BSLCTQMGPODLEW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 77.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|