About 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane
4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane (PubChem CID 143589151) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane.
Molecular Properties
| Compound Name | 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane |
| PubChem CID | 143589151 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane |
| SMILES | C/N=C(\C)c1cc(C(C)C)c(O)cc1O.CC |
| InChI | InChI=1S/C12H17NO2.C2H6/c1-7(2)9-5-10(8(3)13-4)12(15)6-11(9)14;1-2/h5-7,14-15H,1-4H3;1-2H3/b13-8+; |
| InChIKey | ZXBDSNFMMHCELQ-FNXZNAJJSA-N |
| XLogP | 3.69 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane?
The IUPAC name of 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane (CID 143589151) is 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane.
What is the SMILES notation for 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane?
The canonical SMILES for 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane is C/N=C(\C)c1cc(C(C)C)c(O)cc1O.CC.
What is the InChIKey of 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane?
The InChIKey is ZXBDSNFMMHCELQ-FNXZNAJJSA-N. The full InChI is InChI=1S/C12H17NO2.C2H6/c1-7(2)9-5-10(8(3)13-4)12(15)6-11(9)14;1-2/h5-7,14-15H,1-4H3;1-2H3/b13-8+;.
What are the key properties of 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane?
4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane has a molecular weight of 237.34 g/mol, XLogP of 3.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(C,N-dimethylcarbonimidoyl)-6-propan-2-ylbenzene-1,3-diol;ethane is sourced from PubChem (CID 143589151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).