C11H15ClN2 — CID 143590334
2-chloro-3,5-dimethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine (PubChem CID 143590334) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is 2-chloro-3,5-dimethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine.
| Compound Name | 2-chloro-3,5-dimethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine |
|---|---|
| PubChem CID | 143590334 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-chloro-3,5-dimethyl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine |
| SMILES | Cc1cc2c(nc1Cl)CCNCC2C |
| InChI | InChI=1S/C11H15ClN2/c1-7-5-9-8(2)6-13-4-3-10(9)14-11(7)12/h5,8,13H,3-4,6H2,1-2H3 |
| InChIKey | YYJRQRFPFSQQMD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|