C27H46N4 — CID 143590504
acetylene;heptane;2-[(1E)-2-methyl-4-(methylamino)penta-1,4-dienyl]-1-[(3E,5Z)-8-methylnona-1,3,5,8-tetraen-4-yl]guanidine (PubChem CID 143590504) has the molecular formula C27H46N4 and a molecular weight of 426.69 g/mol. Its IUPAC name is acetylene;heptane;2-[(1E)-2-methyl-4-(methylamino)penta-1,4-dienyl]-1-[(3E,5Z)-8-methylnona-1,3,5,8-tetraen-4-yl]guanidine.
| Compound Name | acetylene;heptane;2-[(1E)-2-methyl-4-(methylamino)penta-1,4-dienyl]-1-[(3E,5Z)-8-methylnona-1,3,5,8-tetraen-4-yl]guanidine |
|---|---|
| PubChem CID | 143590504 |
| Molecular Formula | C27H46N4 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.37 |
| IUPAC Name | acetylene;heptane;2-[(1E)-2-methyl-4-(methylamino)penta-1,4-dienyl]-1-[(3E,5Z)-8-methylnona-1,3,5,8-tetraen-4-yl]guanidine |
| SMILES | C#C.C=C/C=C(\C=C/CC(=C)C)N/C(N)=N/C=C(\C)CC(=C)NC.CCCCCCC |
| InChI | InChI=1S/C18H28N4.C7H16.C2H2/c1-7-9-17(11-8-10-14(2)3)22-18(19)21-13-15(4)12-16(5)20-6;1-3-5-7-6-4-2;1-2/h7-9,11,13,20H,1-2,5,10,12H2,3-4,6H3,(H3,19,21,22);3-7H2,1-2H3;1-2H/b11-8-,15-13+,17-9+;; |
| InChIKey | MTYZOJMASQQEFS-POXXPTDXSA-N |
| XLogP | 6.74 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|