C29H32N2O4S — CID 143590547
19-cyclohexyl-10-(3-hydroxyazetidin-1-yl)sulfanyl-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-15-carboxylic acid (PubChem CID 143590547) has the molecular formula C29H32N2O4S and a molecular weight of 504.65 g/mol. Its IUPAC name is 19-cyclohexyl-10-(3-hydroxyazetidin-1-yl)sulfanyl-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-15-carboxylic acid.
| Compound Name | 19-cyclohexyl-10-(3-hydroxyazetidin-1-yl)sulfanyl-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-15-carboxylic acid |
|---|---|
| PubChem CID | 143590547 |
| Molecular Formula | C29H32N2O4S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 19-cyclohexyl-10-(3-hydroxyazetidin-1-yl)sulfanyl-5-methoxy-12-azapentacyclo[10.7.0.02,7.08,10.013,18]nonadeca-1(19),2(7),3,5,13(18),14,16-heptaene-15-carboxylic acid |
| SMILES | COc1ccc2c(c1)C1CC1(SN1CC(O)C1)Cn1c-2c(C2CCCCC2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C29H32N2O4S/c1-35-20-8-10-21-23(12-20)24-13-29(24,36-30-14-19(32)15-30)16-31-25-11-18(28(33)34)7-9-22(25)26(27(21)31)17-5-3-2-4-6-17/h7-12,17,19,24,32H,2-6,13-16H2,1H3,(H,33,34) |
| InChIKey | KHRILSWWLAIYJN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|