C28H47I — CID 143591175
(1R,3aR,5aR,5bR,11aR)-9-iodo-1,3a,5a,5b,8,8,11a-heptamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene (PubChem CID 143591175) has the molecular formula C28H47I and a molecular weight of 510.59 g/mol. Its IUPAC name is (1R,3aR,5aR,5bR,11aR)-9-iodo-1,3a,5a,5b,8,8,11a-heptamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene.
| Compound Name | (1R,3aR,5aR,5bR,11aR)-9-iodo-1,3a,5a,5b,8,8,11a-heptamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene |
|---|---|
| PubChem CID | 143591175 |
| Molecular Formula | C28H47I |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.27 |
| IUPAC Name | (1R,3aR,5aR,5bR,11aR)-9-iodo-1,3a,5a,5b,8,8,11a-heptamethyl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene |
| SMILES | CC1CC[C@]2(C)CC[C@]3(C)C(CCC4[C@@]5(C)CCC(I)C(C)(C)C5CC[C@]43C)C12 |
| InChI | InChI=1S/C28H47I/c1-18-10-13-25(4)16-17-27(6)19(23(18)25)8-9-21-26(5)14-12-22(29)24(2,3)20(26)11-15-28(21,27)7/h18-23H,8-17H2,1-7H3/t18?,19?,20?,21?,22?,23?,25-,26+,27-,28-/m1/s1 |
| InChIKey | GMDQFFINLDQPMQ-BQQOYOIHSA-N |
| XLogP | 8.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|