C31H56O2 — CID 143591191
4-[(4bR)-2-ethyl-7-(hydroxymethyl)-1,4a,4b,7-tetramethyl-8-[(3R)-2-methylpent-1-en-3-yl]-2,3,4,5,6,8,8a,9,10,10a-decahydrophenanthren-1-yl]butan-2-ol (PubChem CID 143591191) has the molecular formula C31H56O2 and a molecular weight of 460.79 g/mol. Its IUPAC name is 4-[(4bR)-2-ethyl-7-(hydroxymethyl)-1,4a,4b,7-tetramethyl-8-[(3R)-2-methylpent-1-en-3-yl]-2,3,4,5,6,8,8a,9,10,10a-decahydrophenanthren-1-yl]butan-2-ol.
| Compound Name | 4-[(4bR)-2-ethyl-7-(hydroxymethyl)-1,4a,4b,7-tetramethyl-8-[(3R)-2-methylpent-1-en-3-yl]-2,3,4,5,6,8,8a,9,10,10a-decahydrophenanthren-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 143591191 |
| Molecular Formula | C31H56O2 |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 460.43 |
| IUPAC Name | 4-[(4bR)-2-ethyl-7-(hydroxymethyl)-1,4a,4b,7-tetramethyl-8-[(3R)-2-methylpent-1-en-3-yl]-2,3,4,5,6,8,8a,9,10,10a-decahydrophenanthren-1-yl]butan-2-ol |
| SMILES | C=C(C)C(CC)C1C2CCC3C(C)(CCC(C)O)C(CC)CCC3(C)[C@]2(C)CCC1(C)CO |
| InChI | InChI=1S/C31H56O2/c1-10-23-15-17-31(9)26(29(23,7)16-14-22(5)33)13-12-25-27(24(11-2)21(3)4)28(6,20-32)18-19-30(25,31)8/h22-27,32-33H,3,10-20H2,1-2,4-9H3/t22?,23?,24?,25?,26?,27?,28?,29?,30-,31?/m1/s1 |
| InChIKey | GAVAVOGIWRZMHS-QWDWMDCYSA-N |
| XLogP | 8.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|