C29H42O2 — CID 143591208
(1R,3aS,5aR,5bR,11aR)-5a,5b,8,11a-tetramethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,10,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carbaldehyde (PubChem CID 143591208) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is (1R,3aS,5aR,5bR,11aR)-5a,5b,8,11a-tetramethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,10,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carbaldehyde.
| Compound Name | (1R,3aS,5aR,5bR,11aR)-5a,5b,8,11a-tetramethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,10,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carbaldehyde |
|---|---|
| PubChem CID | 143591208 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | (1R,3aS,5aR,5bR,11aR)-5a,5b,8,11a-tetramethyl-9-oxo-1-prop-1-en-2-yl-1,2,3,4,5,6,7,10,11,11b,12,13,13a,13b-tetradecahydrocyclopenta[a]chrysene-3a-carbaldehyde |
| SMILES | C=C(C)C1CC[C@]2(C=O)CC[C@]3(C)C(CCC4[C@@]5(C)CCC(=O)C(C)=C5CC[C@]43C)C12 |
| InChI | InChI=1S/C29H42O2/c1-18(2)20-9-14-29(17-30)16-15-27(5)22(25(20)29)7-8-24-26(4)12-11-23(31)19(3)21(26)10-13-28(24,27)6/h17,20,22,24-25H,1,7-16H2,2-6H3/t20?,22?,24?,25?,26-,27+,28+,29+/m0/s1 |
| InChIKey | BGVSVXTXHJHLDS-NFXIGTFYSA-N |
| XLogP | 7.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|