About 3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine
3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 14359128) has the molecular formula C4H8N4S
and a molecular weight of 144.20 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine.
Analyze 3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine?
The IUPAC name of 3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine (CID 14359128) is 3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine.
What is the SMILES notation for 3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine?
The canonical SMILES for 3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine is CN(C)c1nsc(N)n1.
What is the InChIKey of 3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine?
The InChIKey is KFFXIDGFYLOKMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4S/c1-8(2)4-6-3(5)9-7-4/h1-2H3,(H2,5,6,7).
What are the key properties of 3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine?
3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine has a molecular weight of 144.20 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-dimethyl-1,2,4-thiadiazole-3,5-diamine is sourced from PubChem (CID 14359128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).