C31H56O2 — CID 143591347
(10aR)-7-butyl-8-(hydroxymethyl)-1,1,4a,10a,10b-pentamethyl-2,3,4,4b,5,6,6a,7,8,9,10,11,12,12a-tetradecahydrochrysen-2-ol;prop-1-ene (PubChem CID 143591347) has the molecular formula C31H56O2 and a molecular weight of 460.79 g/mol. Its IUPAC name is (10aR)-7-butyl-8-(hydroxymethyl)-1,1,4a,10a,10b-pentamethyl-2,3,4,4b,5,6,6a,7,8,9,10,11,12,12a-tetradecahydrochrysen-2-ol;prop-1-ene.
| Compound Name | (10aR)-7-butyl-8-(hydroxymethyl)-1,1,4a,10a,10b-pentamethyl-2,3,4,4b,5,6,6a,7,8,9,10,11,12,12a-tetradecahydrochrysen-2-ol;prop-1-ene |
|---|---|
| PubChem CID | 143591347 |
| Molecular Formula | C31H56O2 |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 460.43 |
| IUPAC Name | (10aR)-7-butyl-8-(hydroxymethyl)-1,1,4a,10a,10b-pentamethyl-2,3,4,4b,5,6,6a,7,8,9,10,11,12,12a-tetradecahydrochrysen-2-ol;prop-1-ene |
| SMILES | C=CC.CCCCC1C(CO)CC[C@]2(C)C1CCC1C3(C)CCC(O)C(C)(C)C3CCC12C |
| InChI | InChI=1S/C28H50O2.C3H6/c1-7-8-9-20-19(18-29)12-16-27(5)21(20)10-11-23-26(4)15-14-24(30)25(2,3)22(26)13-17-28(23,27)6;1-3-2/h19-24,29-30H,7-18H2,1-6H3;3H,1H2,2H3/t19?,20?,21?,22?,23?,24?,26?,27-,28?;/m1./s1 |
| InChIKey | DIWPDZVAPNHAMA-YNUCOMHHSA-N |
| XLogP | 8.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|