About 1-hydroxy-4-methylidenepiperidine;phenylmethanol
1-hydroxy-4-methylidenepiperidine;phenylmethanol (PubChem CID 143591537) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-hydroxy-4-methylidenepiperidine;phenylmethanol.
Molecular Properties
| Compound Name | 1-hydroxy-4-methylidenepiperidine;phenylmethanol |
| PubChem CID | 143591537 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-hydroxy-4-methylidenepiperidine;phenylmethanol |
| SMILES | C=C1CCN(O)CC1.OCc1ccccc1 |
| InChI | InChI=1S/C7H8O.C6H11NO/c8-6-7-4-2-1-3-5-7;1-6-2-4-7(8)5-3-6/h1-5,8H,6H2;8H,1-5H2 |
| InChIKey | VYMAKUZVBWNLMM-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-4-methylidenepiperidine;phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-4-methylidenepiperidine;phenylmethanol?
The IUPAC name of 1-hydroxy-4-methylidenepiperidine;phenylmethanol (CID 143591537) is 1-hydroxy-4-methylidenepiperidine;phenylmethanol.
What is the SMILES notation for 1-hydroxy-4-methylidenepiperidine;phenylmethanol?
The canonical SMILES for 1-hydroxy-4-methylidenepiperidine;phenylmethanol is C=C1CCN(O)CC1.OCc1ccccc1.
What is the InChIKey of 1-hydroxy-4-methylidenepiperidine;phenylmethanol?
The InChIKey is VYMAKUZVBWNLMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H11NO/c8-6-7-4-2-1-3-5-7;1-6-2-4-7(8)5-3-6/h1-5,8H,6H2;8H,1-5H2.
What are the key properties of 1-hydroxy-4-methylidenepiperidine;phenylmethanol?
1-hydroxy-4-methylidenepiperidine;phenylmethanol has a molecular weight of 221.30 g/mol, XLogP of 2.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-4-methylidenepiperidine;phenylmethanol is sourced from PubChem (CID 143591537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).