C19H34N4O3 — CID 143591983
ethyl 3-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]pyrrolidine-1-carboxylate (PubChem CID 143591983) has the molecular formula C19H34N4O3 and a molecular weight of 366.51 g/mol. Its IUPAC name is ethyl 3-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | ethyl 3-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 143591983 |
| Molecular Formula | C19H34N4O3 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | ethyl 3-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCC(N(C(N)=O)C3CCCCC3)CC2)C1 |
| InChI | InChI=1S/C19H34N4O3/c1-2-26-19(25)22-13-10-17(14-22)21-11-8-16(9-12-21)23(18(20)24)15-6-4-3-5-7-15/h15-17H,2-14H2,1H3,(H2,20,24) |
| InChIKey | DBDAWFWTFMQZHP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |