C19H34O5 — CID 143592307
(7S,9R,13S)-12-hydroxy-7-methoxy-3,7,9,11,13-pentamethyl-oxacyclotetradecane-2,10-dione (PubChem CID 143592307) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is (7S,9R,13S)-12-hydroxy-7-methoxy-3,7,9,11,13-pentamethyl-oxacyclotetradecane-2,10-dione.
| Compound Name | (7S,9R,13S)-12-hydroxy-7-methoxy-3,7,9,11,13-pentamethyl-oxacyclotetradecane-2,10-dione |
|---|---|
| PubChem CID | 143592307 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (7S,9R,13S)-12-hydroxy-7-methoxy-3,7,9,11,13-pentamethyl-oxacyclotetradecane-2,10-dione |
| SMILES | CO[C@@]1(C)CCCC(C)C(=O)OC[C@H](C)C(O)C(C)C(=O)[C@H](C)C1 |
| InChI | InChI=1S/C19H34O5/c1-12-8-7-9-19(5,23-6)10-13(2)16(20)15(4)17(21)14(3)11-24-18(12)22/h12-15,17,21H,7-11H2,1-6H3/t12?,13-,14+,15?,17?,19+/m1/s1 |
| InChIKey | RZDDEBCMJQNVEW-XPEHLCIWSA-N |
| XLogP | 2.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |