About ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine
ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine (PubChem CID 143592739) has the molecular formula C14H24BrNO2
and a molecular weight of 318.26 g/mol. Its IUPAC name is ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine.
Molecular Properties
| Compound Name | ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine |
| PubChem CID | 143592739 |
| Molecular Formula | C14H24BrNO2 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine |
| SMILES | CC.CCOC(=O)Cc1cccc(CBr)c1.CN |
| InChI | InChI=1S/C11H13BrO2.C2H6.CH5N/c1-2-14-11(13)7-9-4-3-5-10(6-9)8-12;2*1-2/h3-6H,2,7-8H2,1H3;1-2H3;2H2,1H3 |
| InChIKey | LQXSGNWYPIXWAZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine?
The IUPAC name of ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine (CID 143592739) is ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine.
What is the SMILES notation for ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine?
The canonical SMILES for ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine is CC.CCOC(=O)Cc1cccc(CBr)c1.CN.
What is the InChIKey of ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine?
The InChIKey is LQXSGNWYPIXWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO2.C2H6.CH5N/c1-2-14-11(13)7-9-4-3-5-10(6-9)8-12;2*1-2/h3-6H,2,7-8H2,1H3;1-2H3;2H2,1H3.
What are the key properties of ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine?
ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine has a molecular weight of 318.26 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 2-[3-(bromomethyl)phenyl]acetate;methanamine is sourced from PubChem (CID 143592739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).