About 3-methyl-1,8-dihydrocyclohepta[b]pyrrole
3-methyl-1,8-dihydrocyclohepta[b]pyrrole (PubChem CID 143592907) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 3-methyl-1,8-dihydrocyclohepta[b]pyrrole.
Molecular Properties
| Compound Name | 3-methyl-1,8-dihydrocyclohepta[b]pyrrole |
| PubChem CID | 143592907 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3-methyl-1,8-dihydrocyclohepta[b]pyrrole |
| SMILES | Cc1c[nH]c2c1C=CC=CC2 |
| InChI | InChI=1S/C10H11N/c1-8-7-11-10-6-4-2-3-5-9(8)10/h2-5,7,11H,6H2,1H3 |
| InChIKey | GIKUKGUDTCAWFO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methyl-1,8-dihydrocyclohepta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,8-dihydrocyclohepta[b]pyrrole?
The IUPAC name of 3-methyl-1,8-dihydrocyclohepta[b]pyrrole (CID 143592907) is 3-methyl-1,8-dihydrocyclohepta[b]pyrrole.
What is the SMILES notation for 3-methyl-1,8-dihydrocyclohepta[b]pyrrole?
The canonical SMILES for 3-methyl-1,8-dihydrocyclohepta[b]pyrrole is Cc1c[nH]c2c1C=CC=CC2.
What is the InChIKey of 3-methyl-1,8-dihydrocyclohepta[b]pyrrole?
The InChIKey is GIKUKGUDTCAWFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-8-7-11-10-6-4-2-3-5-9(8)10/h2-5,7,11H,6H2,1H3.
What are the key properties of 3-methyl-1,8-dihydrocyclohepta[b]pyrrole?
3-methyl-1,8-dihydrocyclohepta[b]pyrrole has a molecular weight of 145.20 g/mol, XLogP of 2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,8-dihydrocyclohepta[b]pyrrole is sourced from PubChem (CID 143592907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).