C16H22N4OS — CID 143593067
6-(aminosulfanylamino)-N-(2-methylquinolin-4-yl)hexanamide (PubChem CID 143593067) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 6-(aminosulfanylamino)-N-(2-methylquinolin-4-yl)hexanamide.
| Compound Name | 6-(aminosulfanylamino)-N-(2-methylquinolin-4-yl)hexanamide |
|---|---|
| PubChem CID | 143593067 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 6-(aminosulfanylamino)-N-(2-methylquinolin-4-yl)hexanamide |
| SMILES | Cc1cc(NC(=O)CCCCCNSN)c2ccccc2n1 |
| InChI | InChI=1S/C16H22N4OS/c1-12-11-15(13-7-4-5-8-14(13)19-12)20-16(21)9-3-2-6-10-18-22-17/h4-5,7-8,11,18H,2-3,6,9-10,17H2,1H3,(H,19,20,21) |
| InChIKey | KQVJZKPBOOJMEP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|