About (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide
(Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide (PubChem CID 143593265) has the molecular formula C12H21N3O2
and a molecular weight of 239.32 g/mol. Its IUPAC name is (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide.
Molecular Properties
| Compound Name | (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide |
| PubChem CID | 143593265 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide |
| SMILES | C=C(/C=C\C)CCC.NC(=O)C1CNC(=O)N1 |
| InChI | InChI=1S/C8H14.C4H7N3O2/c1-4-6-8(3)7-5-2;5-3(8)2-1-6-4(9)7-2/h4,6H,3,5,7H2,1-2H3;2H,1H2,(H2,5,8)(H2,6,7,9)/b6-4-; |
| InChIKey | KJADPTQVWAFUBC-YHSAGPEESA-N |
| XLogP | 1.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide?
The IUPAC name of (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide (CID 143593265) is (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide.
What is the SMILES notation for (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide?
The canonical SMILES for (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide is C=C(/C=C\C)CCC.NC(=O)C1CNC(=O)N1.
What is the InChIKey of (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide?
The InChIKey is KJADPTQVWAFUBC-YHSAGPEESA-N. The full InChI is InChI=1S/C8H14.C4H7N3O2/c1-4-6-8(3)7-5-2;5-3(8)2-1-6-4(9)7-2/h4,6H,3,5,7H2,1-2H3;2H,1H2,(H2,5,8)(H2,6,7,9)/b6-4-;.
What are the key properties of (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide?
(Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide has a molecular weight of 239.32 g/mol, XLogP of 1.07, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-methylidenehept-2-ene;2-oxoimidazolidine-4-carboxamide is sourced from PubChem (CID 143593265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).