C25H28N6S — CID 143593538
6-[1-[(dimethylamino)methyl]cyclopropyl]-1-methyl-4-[4-(phenylsulfanylamino)phenyl]pyrazolo[5,4-b]pyridin-3-amine (PubChem CID 143593538) has the molecular formula C25H28N6S and a molecular weight of 444.61 g/mol. Its IUPAC name is 6-[1-[(dimethylamino)methyl]cyclopropyl]-1-methyl-4-[4-(phenylsulfanylamino)phenyl]pyrazolo[5,4-b]pyridin-3-amine.
| Compound Name | 6-[1-[(dimethylamino)methyl]cyclopropyl]-1-methyl-4-[4-(phenylsulfanylamino)phenyl]pyrazolo[5,4-b]pyridin-3-amine |
|---|---|
| PubChem CID | 143593538 |
| Molecular Formula | C25H28N6S |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 6-[1-[(dimethylamino)methyl]cyclopropyl]-1-methyl-4-[4-(phenylsulfanylamino)phenyl]pyrazolo[5,4-b]pyridin-3-amine |
| SMILES | CN(C)CC1(c2cc(-c3ccc(NSc4ccccc4)cc3)c3c(N)nn(C)c3n2)CC1 |
| InChI | InChI=1S/C25H28N6S/c1-30(2)16-25(13-14-25)21-15-20(22-23(26)28-31(3)24(22)27-21)17-9-11-18(12-10-17)29-32-19-7-5-4-6-8-19/h4-12,15,29H,13-14,16H2,1-3H3,(H2,26,28) |
| InChIKey | YFAASXDHZZCSAY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|