C36H27F34NOS2 — CID 143593643
2,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-6-methylphenol;4-methylaniline (PubChem CID 143593643) has the molecular formula C36H27F34NOS2 and a molecular weight of 1199.68 g/mol. Its IUPAC name is 2,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-6-methylphenol;4-methylaniline.
| Compound Name | 2,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-6-methylphenol;4-methylaniline |
|---|---|
| PubChem CID | 143593643 |
| Molecular Formula | C36H27F34NOS2 |
| Molecular Weight | 1199.68 g/mol |
| Exact Mass | 1199.10 |
| IUPAC Name | 2,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylsulfanylmethyl)-6-methylphenol;4-methylaniline |
| SMILES | Cc1cc(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(CSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1O.Cc1ccc(N)cc1 |
| InChI | InChI=1S/C29H18F34OS2.C7H9N/c1-10-6-11(8-65-4-2-14(30,31)16(34,35)18(38,39)20(42,43)22(46,47)24(50,51)26(54,55)28(58,59)60)7-12(13(10)64)9-66-5-3-15(32,33)17(36,37)19(40,41)21(44,45)23(48,49)25(52,53)27(56,57)29(61,62)63;1-6-2-4-7(8)5-3-6/h6-7,64H,2-5,8-9H2,1H3;2-5H,8H2,1H3 |
| InChIKey | UAAOKRSMKULOFC-UHFFFAOYSA-N |
| XLogP | 16.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1199.68 |
| LogP ≤ 5 | 16.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|