C20H24ClFN2O5 — CID 143593750
N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-(1-methylcyclopentyl)-1-oxopropan-2-yl]-5-chlorofuran-2-carboxamide (PubChem CID 143593750) has the molecular formula C20H24ClFN2O5 and a molecular weight of 426.87 g/mol. Its IUPAC name is N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-(1-methylcyclopentyl)-1-oxopropan-2-yl]-5-chlorofuran-2-carboxamide.
| Compound Name | N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-(1-methylcyclopentyl)-1-oxopropan-2-yl]-5-chlorofuran-2-carboxamide |
|---|---|
| PubChem CID | 143593750 |
| Molecular Formula | C20H24ClFN2O5 |
| Molecular Weight | 426.87 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-[(2S)-1-[(3aS,6S,6aS)-6-fluoro-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-3-(1-methylcyclopentyl)-1-oxopropan-2-yl]-5-chlorofuran-2-carboxamide |
| SMILES | CC1(C[C@H](NC(=O)c2ccc(Cl)o2)C(=O)N2C[C@H](F)[C@H]3OCC(=O)[C@H]32)CCCC1 |
| InChI | InChI=1S/C20H24ClFN2O5/c1-20(6-2-3-7-20)8-12(23-18(26)14-4-5-15(21)29-14)19(27)24-9-11(22)17-16(24)13(25)10-28-17/h4-5,11-12,16-17H,2-3,6-10H2,1H3,(H,23,26)/t11-,12-,16+,17+/m0/s1 |
| InChIKey | OQBSDHLALMGHBL-IYVPYFHTSA-N |
| XLogP | 2.52 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.87 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |