C17H35NO6 — CID 143593783
tert-butyl (3aS,6aS)-6-hydroxy-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate;ethane (PubChem CID 143593783) has the molecular formula C17H35NO6 and a molecular weight of 349.47 g/mol. Its IUPAC name is tert-butyl (3aS,6aS)-6-hydroxy-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate;ethane.
| Compound Name | tert-butyl (3aS,6aS)-6-hydroxy-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate;ethane |
|---|---|
| PubChem CID | 143593783 |
| Molecular Formula | C17H35NO6 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | tert-butyl (3aS,6aS)-6-hydroxy-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylate;ethane |
| SMILES | CC.CC.COC1(OC)CO[C@@H]2C(O)CN(C(=O)OC(C)(C)C)[C@@H]21 |
| InChI | InChI=1S/C13H23NO6.2C2H6/c1-12(2,3)20-11(16)14-6-8(15)9-10(14)13(17-4,18-5)7-19-9;2*1-2/h8-10,15H,6-7H2,1-5H3;2*1-2H3/t8?,9-,10+;;/m1../s1 |
| InChIKey | AQJHFUMJEXTVKF-ZHNKMADDSA-N |
| XLogP | 2.41 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|