About 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen
1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen (PubChem CID 143594251) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen.
Molecular Properties
| Compound Name | 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen |
| PubChem CID | 143594251 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen |
| SMILES | CC.CC.CNCC(=O)C1=CC(C)C(C)C=C1.[H][H] |
| InChI | InChI=1S/C11H17NO.2C2H6.H2/c1-8-4-5-10(6-9(8)2)11(13)7-12-3;2*1-2;/h4-6,8-9,12H,7H2,1-3H3;2*1-2H3;1H |
| InChIKey | LYBFJAAPEPQHGL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen?
The IUPAC name of 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen (CID 143594251) is 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen.
What is the SMILES notation for 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen?
The canonical SMILES for 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen is CC.CC.CNCC(=O)C1=CC(C)C(C)C=C1.[H][H].
What is the InChIKey of 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen?
The InChIKey is LYBFJAAPEPQHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO.2C2H6.H2/c1-8-4-5-10(6-9(8)2)11(13)7-12-3;2*1-2;/h4-6,8-9,12H,7H2,1-3H3;2*1-2H3;1H.
What are the key properties of 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen?
1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen has a molecular weight of 241.42 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylcyclohexa-1,5-dien-1-yl)-2-(methylamino)ethanone;ethane;molecular hydrogen is sourced from PubChem (CID 143594251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).