About (3-bromophenyl)-(furan-3-yl)methanamine;methanethione
(3-bromophenyl)-(furan-3-yl)methanamine;methanethione (PubChem CID 143594440) has the molecular formula C12H12BrNOS
and a molecular weight of 298.21 g/mol. Its IUPAC name is (3-bromophenyl)-(furan-3-yl)methanamine;methanethione.
Molecular Properties
| Compound Name | (3-bromophenyl)-(furan-3-yl)methanamine;methanethione |
| PubChem CID | 143594440 |
| Molecular Formula | C12H12BrNOS |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | (3-bromophenyl)-(furan-3-yl)methanamine;methanethione |
| SMILES | C=S.NC(c1ccoc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H10BrNO.CH2S/c12-10-3-1-2-8(6-10)11(13)9-4-5-14-7-9;1-2/h1-7,11H,13H2;1H2 |
| InChIKey | IMVYTRNQJDKGKR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3-bromophenyl)-(furan-3-yl)methanamine;methanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)-(furan-3-yl)methanamine;methanethione?
The IUPAC name of (3-bromophenyl)-(furan-3-yl)methanamine;methanethione (CID 143594440) is (3-bromophenyl)-(furan-3-yl)methanamine;methanethione.
What is the SMILES notation for (3-bromophenyl)-(furan-3-yl)methanamine;methanethione?
The canonical SMILES for (3-bromophenyl)-(furan-3-yl)methanamine;methanethione is C=S.NC(c1ccoc1)c1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl)-(furan-3-yl)methanamine;methanethione?
The InChIKey is IMVYTRNQJDKGKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrNO.CH2S/c12-10-3-1-2-8(6-10)11(13)9-4-5-14-7-9;1-2/h1-7,11H,13H2;1H2.
What are the key properties of (3-bromophenyl)-(furan-3-yl)methanamine;methanethione?
(3-bromophenyl)-(furan-3-yl)methanamine;methanethione has a molecular weight of 298.21 g/mol, XLogP of 3.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)-(furan-3-yl)methanamine;methanethione is sourced from PubChem (CID 143594440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).