About (4-methylcyclohexyl)methanol;pyrazine
(4-methylcyclohexyl)methanol;pyrazine (PubChem CID 143594726) has the molecular formula C12H20N2O
and a molecular weight of 208.31 g/mol. Its IUPAC name is (4-methylcyclohexyl)methanol;pyrazine.
Molecular Properties
| Compound Name | (4-methylcyclohexyl)methanol;pyrazine |
| PubChem CID | 143594726 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (4-methylcyclohexyl)methanol;pyrazine |
| SMILES | CC1CCC(CO)CC1.c1cnccn1 |
| InChI | InChI=1S/C8H16O.C4H4N2/c1-7-2-4-8(6-9)5-3-7;1-2-6-4-3-5-1/h7-9H,2-6H2,1H3;1-4H |
| InChIKey | TXEOBUZBLSXCDT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methylcyclohexyl)methanol;pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylcyclohexyl)methanol;pyrazine?
The IUPAC name of (4-methylcyclohexyl)methanol;pyrazine (CID 143594726) is (4-methylcyclohexyl)methanol;pyrazine.
What is the SMILES notation for (4-methylcyclohexyl)methanol;pyrazine?
The canonical SMILES for (4-methylcyclohexyl)methanol;pyrazine is CC1CCC(CO)CC1.c1cnccn1.
What is the InChIKey of (4-methylcyclohexyl)methanol;pyrazine?
The InChIKey is TXEOBUZBLSXCDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C4H4N2/c1-7-2-4-8(6-9)5-3-7;1-2-6-4-3-5-1/h7-9H,2-6H2,1H3;1-4H.
What are the key properties of (4-methylcyclohexyl)methanol;pyrazine?
(4-methylcyclohexyl)methanol;pyrazine has a molecular weight of 208.31 g/mol, XLogP of 2.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylcyclohexyl)methanol;pyrazine is sourced from PubChem (CID 143594726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).