C19H24F2N3OP — CID 143594814
4-(1-amino-2,2-difluoro-2-phosphanylethyl)-N-(4-cyanocyclohexyl)-N-cyclopropylbenzamide (PubChem CID 143594814) has the molecular formula C19H24F2N3OP and a molecular weight of 379.39 g/mol. Its IUPAC name is 4-(1-amino-2,2-difluoro-2-phosphanylethyl)-N-(4-cyanocyclohexyl)-N-cyclopropylbenzamide.
| Compound Name | 4-(1-amino-2,2-difluoro-2-phosphanylethyl)-N-(4-cyanocyclohexyl)-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 143594814 |
| Molecular Formula | C19H24F2N3OP |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-(1-amino-2,2-difluoro-2-phosphanylethyl)-N-(4-cyanocyclohexyl)-N-cyclopropylbenzamide |
| SMILES | N#CC1CCC(N(C(=O)c2ccc(C(N)C(F)(F)P)cc2)C2CC2)CC1 |
| InChI | InChI=1S/C19H24F2N3OP/c20-19(21,26)17(23)13-3-5-14(6-4-13)18(25)24(16-9-10-16)15-7-1-12(11-22)2-8-15/h3-6,12,15-17H,1-2,7-10,23,26H2 |
| InChIKey | VEMMTNDNVAXNRX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|