C17H19ClFN3O2 — CID 143595116
(3-chloro-2-fluorophenyl)-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanol (PubChem CID 143595116) has the molecular formula C17H19ClFN3O2 and a molecular weight of 351.81 g/mol. Its IUPAC name is (3-chloro-2-fluorophenyl)-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanol.
| Compound Name | (3-chloro-2-fluorophenyl)-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanol |
|---|---|
| PubChem CID | 143595116 |
| Molecular Formula | C17H19ClFN3O2 |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (3-chloro-2-fluorophenyl)-[2-(pyridin-3-yloxymethyl)piperazin-1-yl]methanol |
| SMILES | OC(c1cccc(Cl)c1F)N1CCNCC1COc1cccnc1 |
| InChI | InChI=1S/C17H19ClFN3O2/c18-15-5-1-4-14(16(15)19)17(23)22-8-7-21-9-12(22)11-24-13-3-2-6-20-10-13/h1-6,10,12,17,21,23H,7-9,11H2 |
| InChIKey | QLDDAKHRHWAIAH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |