C11H10N2O2 — CID 14359530
2-amino-4-methylquinoline-7-carboxylic acid (PubChem CID 14359530) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-amino-4-methylquinoline-7-carboxylic acid.
| Compound Name | 2-amino-4-methylquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 14359530 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-amino-4-methylquinoline-7-carboxylic acid |
| SMILES | Cc1cc(N)nc2cc(C(=O)O)ccc12 |
| InChI | InChI=1S/C11H10N2O2/c1-6-4-10(12)13-9-5-7(11(14)15)2-3-8(6)9/h2-5H,1H3,(H2,12,13)(H,14,15) |
| InChIKey | KVNVAQLWDWEYIV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |