C26H41BrN4OS — CID 143595384
(3-bromothiophen-2-yl)-(2-propan-2-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methanol;N,N-dipropylcyclobutanamine (PubChem CID 143595384) has the molecular formula C26H41BrN4OS and a molecular weight of 537.61 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-(2-propan-2-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methanol;N,N-dipropylcyclobutanamine.
| Compound Name | (3-bromothiophen-2-yl)-(2-propan-2-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methanol;N,N-dipropylcyclobutanamine |
|---|---|
| PubChem CID | 143595384 |
| Molecular Formula | C26H41BrN4OS |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (3-bromothiophen-2-yl)-(2-propan-2-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methanol;N,N-dipropylcyclobutanamine |
| SMILES | CC(C)c1ncc2c(n1)CCN(C(O)c1sccc1Br)CC2.CCCN(CCC)C1CCC1 |
| InChI | InChI=1S/C16H20BrN3OS.C10H21N/c1-10(2)15-18-9-11-3-6-20(7-4-13(11)19-15)16(21)14-12(17)5-8-22-14;1-3-8-11(9-4-2)10-6-5-7-10/h5,8-10,16,21H,3-4,6-7H2,1-2H3;10H,3-9H2,1-2H3 |
| InChIKey | TXVKOVPGTBXOOK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |