C24H36F3N5O2 — CID 143595444
2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carbaldehyde;2-ethoxy-1,1,1-trifluoro-3-methylbut-2-ene (PubChem CID 143595444) has the molecular formula C24H36F3N5O2 and a molecular weight of 483.58 g/mol. Its IUPAC name is 2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carbaldehyde;2-ethoxy-1,1,1-trifluoro-3-methylbut-2-ene.
| Compound Name | 2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carbaldehyde;2-ethoxy-1,1,1-trifluoro-3-methylbut-2-ene |
|---|---|
| PubChem CID | 143595444 |
| Molecular Formula | C24H36F3N5O2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-7-carbaldehyde;2-ethoxy-1,1,1-trifluoro-3-methylbut-2-ene |
| SMILES | CCOC(=C(C)C)C(F)(F)F.O=CN1CCc2cnc(N3CCN(C4CCC4)CC3)nc2CC1 |
| InChI | InChI=1S/C17H25N5O.C7H11F3O/c23-13-20-6-4-14-12-18-17(19-16(14)5-7-20)22-10-8-21(9-11-22)15-2-1-3-15;1-4-11-6(5(2)3)7(8,9)10/h12-13,15H,1-11H2;4H2,1-3H3 |
| InChIKey | GRNDDHYEDUQHRH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|