C32H41N5O2 — CID 143595455
(3Z)-1-[2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-[(E)-1-phenylmethoxyprop-1-enyl]hexa-3,5-dien-1-one (PubChem CID 143595455) has the molecular formula C32H41N5O2 and a molecular weight of 527.71 g/mol. Its IUPAC name is (3Z)-1-[2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-[(E)-1-phenylmethoxyprop-1-enyl]hexa-3,5-dien-1-one.
| Compound Name | (3Z)-1-[2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-[(E)-1-phenylmethoxyprop-1-enyl]hexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 143595455 |
| Molecular Formula | C32H41N5O2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.33 |
| IUPAC Name | (3Z)-1-[2-(4-cyclobutylpiperazin-1-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-3-[(E)-1-phenylmethoxyprop-1-enyl]hexa-3,5-dien-1-one |
| SMILES | C=C/C=C(CC(=O)N1CCc2cnc(N3CCN(C4CCC4)CC3)nc2CC1)\C(=C/C)OCc1ccccc1 |
| InChI | InChI=1S/C32H41N5O2/c1-3-9-26(30(4-2)39-24-25-10-6-5-7-11-25)22-31(38)36-16-14-27-23-33-32(34-29(27)15-17-36)37-20-18-35(19-21-37)28-12-8-13-28/h3-7,9-11,23,28H,1,8,12-22,24H2,2H3/b26-9-,30-4+ |
| InChIKey | YXYZITMLLRKVGI-VZLXDFEESA-N |
| XLogP | 4.70 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|