About cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide
cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide (PubChem CID 143596119) has the molecular formula C16H27N3O2
and a molecular weight of 293.41 g/mol. Its IUPAC name is cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide.
Molecular Properties
| Compound Name | cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide |
| PubChem CID | 143596119 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide |
| SMILES | C1CCCCC1.CCC(=O)CNC(=O)C1=CN(C)CC=N1 |
| InChI | InChI=1S/C10H15N3O2.C6H12/c1-3-8(14)6-12-10(15)9-7-13(2)5-4-11-9;1-2-4-6-5-3-1/h4,7H,3,5-6H2,1-2H3,(H,12,15);1-6H2 |
| InChIKey | GFZHUJAWPLFJMC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide?
The IUPAC name of cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide (CID 143596119) is cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide.
What is the SMILES notation for cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide?
The canonical SMILES for cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide is C1CCCCC1.CCC(=O)CNC(=O)C1=CN(C)CC=N1.
What is the InChIKey of cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide?
The InChIKey is GFZHUJAWPLFJMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2.C6H12/c1-3-8(14)6-12-10(15)9-7-13(2)5-4-11-9;1-2-4-6-5-3-1/h4,7H,3,5-6H2,1-2H3,(H,12,15);1-6H2.
What are the key properties of cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide?
cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide has a molecular weight of 293.41 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;1-methyl-N-(2-oxobutyl)-2H-pyrazine-5-carboxamide is sourced from PubChem (CID 143596119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).