About (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine
(4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine (PubChem CID 143596418) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine.
Molecular Properties
| Compound Name | (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine |
| PubChem CID | 143596418 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine |
| SMILES | C=C/C=C(/F)C(=C)CCNC |
| InChI | InChI=1S/C9H14FN/c1-4-5-9(10)8(2)6-7-11-3/h4-5,11H,1-2,6-7H2,3H3/b9-5+ |
| InChIKey | KUROJXCNENBIMS-WEVVVXLNSA-N |
| XLogP | 2.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine?
The IUPAC name of (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine (CID 143596418) is (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine.
What is the SMILES notation for (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine?
The canonical SMILES for (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine is C=C/C=C(/F)C(=C)CCNC.
What is the InChIKey of (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine?
The InChIKey is KUROJXCNENBIMS-WEVVVXLNSA-N. The full InChI is InChI=1S/C9H14FN/c1-4-5-9(10)8(2)6-7-11-3/h4-5,11H,1-2,6-7H2,3H3/b9-5+.
What are the key properties of (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine?
(4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine has a molecular weight of 155.22 g/mol, XLogP of 2.19, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-fluoro-N-methyl-3-methylidenehepta-4,6-dien-1-amine is sourced from PubChem (CID 143596418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).