C11H13F3 — CID 143596428
2-propyl-4-(trifluoromethyl)cyclohepta-1,3,5-triene (PubChem CID 143596428) has the molecular formula C11H13F3 and a molecular weight of 202.22 g/mol. Its IUPAC name is 2-propyl-4-(trifluoromethyl)cyclohepta-1,3,5-triene.
| Compound Name | 2-propyl-4-(trifluoromethyl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143596428 |
| Molecular Formula | C11H13F3 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-propyl-4-(trifluoromethyl)cyclohepta-1,3,5-triene |
| SMILES | CCCC1=CCC=CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C11H13F3/c1-2-5-9-6-3-4-7-10(8-9)11(12,13)14/h4,6-8H,2-3,5H2,1H3 |
| InChIKey | IBUAITIZQGKGBD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |