About 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen
4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen (PubChem CID 143596522) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen.
Molecular Properties
| Compound Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen |
| PubChem CID | 143596522 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen |
| SMILES | C=C/C=C(\C=C)n1ccnc(C(=O)NC)c1=O.[H][H] |
| InChI | InChI=1S/C12H13N3O2.H2/c1-4-6-9(5-2)15-8-7-14-10(12(15)17)11(16)13-3;/h4-8H,1-2H2,3H3,(H,13,16);1H/b9-6+; |
| InChIKey | NTEURELFHFCBNF-MLBSPLJJSA-N |
| XLogP | 1.06 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen?
The IUPAC name of 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen (CID 143596522) is 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen.
What is the SMILES notation for 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen?
The canonical SMILES for 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen is C=C/C=C(\C=C)n1ccnc(C(=O)NC)c1=O.[H][H].
What is the InChIKey of 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen?
The InChIKey is NTEURELFHFCBNF-MLBSPLJJSA-N. The full InChI is InChI=1S/C12H13N3O2.H2/c1-4-6-9(5-2)15-8-7-14-10(12(15)17)11(16)13-3;/h4-8H,1-2H2,3H3,(H,13,16);1H/b9-6+;.
What are the key properties of 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen?
4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen has a molecular weight of 233.27 g/mol, XLogP of 1.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3E)-hexa-1,3,5-trien-3-yl]-N-methyl-3-oxopyrazine-2-carboxamide;molecular hydrogen is sourced from PubChem (CID 143596522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).