C15H26N2O2 — CID 143596587
ethane;1-hexan-3-yl-N-methyl-2-oxopyridine-3-carboxamide (PubChem CID 143596587) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is ethane;1-hexan-3-yl-N-methyl-2-oxopyridine-3-carboxamide.
| Compound Name | ethane;1-hexan-3-yl-N-methyl-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 143596587 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | ethane;1-hexan-3-yl-N-methyl-2-oxopyridine-3-carboxamide |
| SMILES | CC.CCCC(CC)n1cccc(C(=O)NC)c1=O |
| InChI | InChI=1S/C13H20N2O2.C2H6/c1-4-7-10(5-2)15-9-6-8-11(13(15)17)12(16)14-3;1-2/h6,8-10H,4-5,7H2,1-3H3,(H,14,16);1-2H3 |
| InChIKey | CYBHVTGSWXENOA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |