C16H22N6O4 — CID 143596613
2-oxo-1-phenylpyrrolidine-3-carbohydrazide;2-oxopyrrolidine-3-carbohydrazide (PubChem CID 143596613) has the molecular formula C16H22N6O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-oxo-1-phenylpyrrolidine-3-carbohydrazide;2-oxopyrrolidine-3-carbohydrazide.
| Compound Name | 2-oxo-1-phenylpyrrolidine-3-carbohydrazide;2-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 143596613 |
| Molecular Formula | C16H22N6O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 2-oxo-1-phenylpyrrolidine-3-carbohydrazide;2-oxopyrrolidine-3-carbohydrazide |
| SMILES | NNC(=O)C1CCN(c2ccccc2)C1=O.NNC(=O)C1CCNC1=O |
| InChI | InChI=1S/C11H13N3O2.C5H9N3O2/c12-13-10(15)9-6-7-14(11(9)16)8-4-2-1-3-5-8;6-8-5(10)3-1-2-7-4(3)9/h1-5,9H,6-7,12H2,(H,13,15);3H,1-2,6H2,(H,7,9)(H,8,10) |
| InChIKey | REMKUOZFYZYTER-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 159.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|