N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen

C6H11N3O — CID 143596624

IUPACN-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen
SMILESCNC(=O)C1=NCCN=C1.[H][H]
InChIInChI=1S/C6H9N3O.H2/c1-7-6(10)5-4-8-2-3-9-5;/h4H,2-3H2,1H3,(H,7,10);1H
InChIKeyYZZDVGRGTUBGFR-UHFFFAOYSA-N
MW141.17 g/mol
LogP-0.50
Rot. Bonds1

About N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen

N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen (PubChem CID 143596624) has the molecular formula C6H11N3O and a molecular weight of 141.17 g/mol. Its IUPAC name is N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen.

Molecular Properties

Compound NameN-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen
PubChem CID143596624
Molecular FormulaC6H11N3O
Molecular Weight141.17 g/mol
Exact Mass141.09
IUPAC NameN-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen
SMILESCNC(=O)C1=NCCN=C1.[H][H]
InChIInChI=1S/C6H9N3O.H2/c1-7-6(10)5-4-8-2-3-9-5;/h4H,2-3H2,1H3,(H,7,10);1H
InChIKeyYZZDVGRGTUBGFR-UHFFFAOYSA-N
XLogP-0.50
TPSA53.82 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.17
LogP ≤ 5-0.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen?
The IUPAC name of N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen (CID 143596624) is N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen.
What is the SMILES notation for N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen?
The canonical SMILES for N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen is CNC(=O)C1=NCCN=C1.[H][H].
What is the InChIKey of N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen?
The InChIKey is YZZDVGRGTUBGFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O.H2/c1-7-6(10)5-4-8-2-3-9-5;/h4H,2-3H2,1H3,(H,7,10);1H.
What are the key properties of N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen?
N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen has a molecular weight of 141.17 g/mol, XLogP of -0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2,3-dihydropyrazine-5-carboxamide;molecular hydrogen is sourced from PubChem (CID 143596624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).