C28H33F2N5O — CID 143596863
2-[3-(diethylamino)propylamino]-8-(2,6-difluorophenyl)-4-[(3E)-2-methylhepta-1,3,5-trien-4-yl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 143596863) has the molecular formula C28H33F2N5O and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-[3-(diethylamino)propylamino]-8-(2,6-difluorophenyl)-4-[(3E)-2-methylhepta-1,3,5-trien-4-yl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[3-(diethylamino)propylamino]-8-(2,6-difluorophenyl)-4-[(3E)-2-methylhepta-1,3,5-trien-4-yl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 143596863 |
| Molecular Formula | C28H33F2N5O |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 2-[3-(diethylamino)propylamino]-8-(2,6-difluorophenyl)-4-[(3E)-2-methylhepta-1,3,5-trien-4-yl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=C(C)/C=C(\C=CC)c1nc(NCCCN(CC)CC)nc2c1ccc(=O)n2-c1c(F)cccc1F |
| InChI | InChI=1S/C28H33F2N5O/c1-6-11-20(18-19(4)5)25-21-14-15-24(36)35(26-22(29)12-9-13-23(26)30)27(21)33-28(32-25)31-16-10-17-34(7-2)8-3/h6,9,11-15,18H,4,7-8,10,16-17H2,1-3,5H3,(H,31,32,33)/b11-6?,20-18+ |
| InChIKey | HWYRUAXDJNXWNJ-WIXUVQRBSA-N |
| XLogP | 5.74 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|