C22H19F2N5O3S — CID 143596990
3-[8-(2,6-difluorophenyl)-2-methoxysulfanyl-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-N,4-dimethylbenzamide (PubChem CID 143596990) has the molecular formula C22H19F2N5O3S and a molecular weight of 471.49 g/mol. Its IUPAC name is 3-[8-(2,6-difluorophenyl)-2-methoxysulfanyl-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-N,4-dimethylbenzamide.
| Compound Name | 3-[8-(2,6-difluorophenyl)-2-methoxysulfanyl-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 143596990 |
| Molecular Formula | C22H19F2N5O3S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 3-[8-(2,6-difluorophenyl)-2-methoxysulfanyl-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-N,4-dimethylbenzamide |
| SMILES | CNC(=O)c1ccc(C)c(-c2nc(SOC)nc3c2CNC(=O)N3c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C22H19F2N5O3S/c1-11-7-8-12(20(30)25-2)9-13(11)17-14-10-26-22(31)29(18-15(23)5-4-6-16(18)24)19(14)28-21(27-17)33-32-3/h4-9H,10H2,1-3H3,(H,25,30)(H,26,31) |
| InChIKey | GHVTXJXGHPOZLN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|