About 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane
2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane (PubChem CID 143597048) has the molecular formula C8H12O7
and a molecular weight of 220.18 g/mol. Its IUPAC name is 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane.
Molecular Properties
| Compound Name | 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane |
| PubChem CID | 143597048 |
| Molecular Formula | C8H12O7 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane |
| SMILES | CC.O=C1OC(C(O)C(=O)O)C(O)=C1O |
| InChI | InChI=1S/C6H6O7.C2H6/c7-1-2(8)6(12)13-4(1)3(9)5(10)11;1-2/h3-4,7-9H,(H,10,11);1-2H3 |
| InChIKey | UBGYOOLCXGZWRJ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane?
The IUPAC name of 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane (CID 143597048) is 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane.
What is the SMILES notation for 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane?
The canonical SMILES for 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane is CC.O=C1OC(C(O)C(=O)O)C(O)=C1O.
What is the InChIKey of 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane?
The InChIKey is UBGYOOLCXGZWRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O7.C2H6/c7-1-2(8)6(12)13-4(1)3(9)5(10)11;1-2/h3-4,7-9H,(H,10,11);1-2H3.
What are the key properties of 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane?
2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane has a molecular weight of 220.18 g/mol, XLogP of -0.29, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydroxy-5-oxo-2H-furan-2-yl)-2-hydroxyacetic acid;ethane is sourced from PubChem (CID 143597048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).